استواستیل-کوآ: تفاوت میان نسخه‌ها

جز
جز (ربات: حذف میان‌ویکی موجود در ویکی‌داده: en, es, fr, gl, it, ja)
| SMILES = O=C(C)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3OP(=O)(O)O
| MeSHName=acetoacetyl+CoA
}}
|Section2= {{Chembox Properties
| Formula=C<sub>25</sub>H<sub>40</sub>N<sub>7</sub>O<sub>18</sub>P<sub>3</sub>S
| BoilingPt=
| Solubility=
}}
|Section3= {{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}}
'''استواستیل-کوآ''' {{انگلیسی|Acetoacetyl-CoA}} با [[فرمول شیمیایی]] C<sub>۲۵</sub>H<sub>۴۰</sub>N<sub>۷</sub>O<sub>۱۸</sub>P<sub>۳</sub>S یک [[ترکیب شیمیایی]] با [[پاب‌کم|شناسه پاب‌کم]] ۷۴ است. که [[جرم مولی]] آن ۸۵۱٫۶۰۹ g/mol می‌باشد.
== جستارهای وابسته ==
*[[ترکیب شیمیایی]]
*[[نام‌گذاری اتحادیه بین‌المللی شیمی محض و کاربردی]]
 
== منابع ==
{{پانویس}}
*{{یادکرد وب|نویسنده = |نشانی =http://goldbook.iupac.org/ |عنوان =IUPAC GOLD BOOK | ناشر = |تاریخ = |تاریخ بازدید =۱۸ مارس ۲۰۱۲ }}
 
{{شیمی-خرد}}
 
[[رده:تیواسترهای کوآنزیم آ]]
[[رده:کوآنزیم‌ها]]
۴٬۴۱۱٬۲۶۸

ویرایش