تفاوت میان نسخه‌های «تریس (۲٫۳-بروموپروپیل) فسفات»

جز
(رده‌انبوه: انتقال از رده:کارسینوژن‌های گروه ۲آ مرکز تحقیقات سرطان به [[رده:کارسینوژن‌های گروه ۲ای پژوهش‌گاه بین‌الملل...)
 
| SMILES = BrCC(Br)COP(=O)(OCC(Br)CBr)OCC(Br)CBr
| InChI = InChI=1S/C9H15Br6O4P/c10-1-7(13)4-17-20(16,18-5-8(14)2-11)19-6-9(15)3-12/h7-9H,1-6H2
}}
| Section2 = {{Chembox Properties
| C=9|H=15|Br=6|O=4|P=1
| BoilingPt =
| Solubility = Insoluble<ref name=GESTIS/>
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt = > {{convert|110|C|F}}<ref name=GESTIS/>
| Autoignition =
}}
}}
 
{{پانویس}}
* {{یادکرد وب|نویسنده = |نشانی =http://goldbook.iupac.org/ |عنوان =IUPAC GOLD BOOK | ناشر = |تاریخ = |تاریخ بازدید =۱۸ مارس ۲۰۱۲}}
 
{{شیمی-خرد}}
 
[[رده:کارسینوژن‌های گروه ۲ای پژوهش‌گاه بین‌المللی سرطان]]
[[رده:ارگانوفسفات‌ها]]
[[رده:اعضای برومید]]
[[رده:ضد شعله‌ها]]
[[رده:کارسینوژن‌های گروه ۲ای پژوهش‌گاه بین‌المللی سرطان]]
[[رده:گروه 2A مواد سرطان‌زای مرکز جهانی تحقیقات سرطان]]
۴٬۱۴۵٬۳۳۱

ویرایش