تفاوت میان نسخه‌های «پنتوپرازول»

اصلاح ارقام، اصلاح فاصلهٔ مجازی
(اصلاح ارقام، اصلاح فاصلهٔ مجازی)
 
| width = 245
| tradename = در ایران : Pantosec
| Drugs.com = {{drugsDrugs.com|monograph|protonix}}
| MedlinePlus = a601246
| licence_EU = yes
| legal_status = فقط با نسخه 
| routes_of_administration = کپسول ، قرص ، آمپول 
| bioavailability = 77%۷۷٪
| metabolism = [[Liverکبد]] ([[CYP2C19]])
| elimination_half-life = 1-2 hours
| excretion = [[Urineادرار]], [[Fecesمدفوع]]
 
<!--Identifiers-->| CAS_number = 102625۱۰۲۶۲۵-70۷۰-7۷
| CAS_number_Ref = {{casciteCascite|correct|??}}
| ATC_prefix = A02
| ATC_suffix = BC02
| PubChem = 4679۴۶۷۹
| IUPHAR_ligand = 7260۷۲۶۰
| DrugBank = DB00213
| DrugBank_Ref = {{drugbankciteDrugbankcite|correct|drugbank}}
| ChemSpiderID = 4517۴۵۱۷
| ChemSpiderID_Ref = {{chemspiderciteChemspidercite|correct|chemspider}}
| UNII = D8TST4O562
| UNII_Ref = {{fdaciteFdacite|correct|FDA}}
| KEGG = D05353
| KEGG_Ref = {{keggciteKeggcite|correct|kegg}}
| ChEBI = 7915۷۹۱۵
| ChEBI_Ref = {{ebiciteEbicite|correct|EBI}}
| ChEMBL = 1502۱۵۰۲
 
<!--Chemical data-->| ChEMBL_Ref = {{ebiciteEbicite|correct|EBI}}
| C = 16۱۶
| F = 2۲
| H = 15۱۵
| N = 3۳
| O = 4۴
| S = 1۱
| molecular_weight = 383.371 g/mol
| SMILES = FC(F)Oc1ccc2[nH]c(nc2c1)S(=O)Cc3nccc(OC)c3OC
| StdInChI = 1S/C16H15F2N3O4S/c1-23-13-5-6-19-12(14(13)24-2)8-26(22)16-20-10-4-3-9(25-15(17)18)7-11(10)21-16/h3-7,15H,8H2,1-2H3,(H,20,21۲۰٬۲۱)
| StdInChIKey = IQPSEEYGBUAQFF-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchiciteStdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchiciteStdinchicite|correct|chemspider}}
| verifiedrevid = 462272670۴۶۲۲۷۲۶۷۰
}}
 
'''پنتوپرازول''' یا''' پانتوپرازول ، '''که با نام تجاری Pantosec در ایران شناخته می شودمی‌شود ، برای درمان و پیشگیری کوتاه مدت [[ازوفاژیت]] مرتبط با [[بازگشت اسید به مری|ریفلاکس گاستروازوفاژیال (GERD)]] و یا بیماریهای مرتبط با ترشح بیش از حد اسید معده مثل [[سندرم زولینگر-الیسون|سندروم زولینگر- الیسون]] تجویز می شودمی‌شود.
 
پنتوپرازول از [[مهارکننده‌های پروتون پمپ|مهار کننده هایکننده‌های پمپ پروتون]] است که منجر به کاهش ترشح اسید معده می شودمی‌شود. این دارو در سلول هایسلول‌های جداری معده با مهار برگشت ناپذیر
Hydrogen potassium ATPase ، ترشح اسید معده را سرکوب می کندمی‌کند. <ref name=":0">{{Cite journal|last=Richardson|first=Paul|last2=Hawkey|first2=Christopher J.|last3=Stack|first3=Dr William A.|date=2012-11-29|title=Proton Pump Inhibitors|url=https://link.springer.com/article/10.2165/00003495-199856030-00002|journal=Drugs|volume=56|issue=3|pages=307–335|doi=10.2165/00003495-199856030-00002|issn=0012-6667|pmid=9777309}}</ref> این دارو برای اولین بار در سال 1994۱۹۹۴ در کشور آلمان فروخته شد و از سال 2010۲۰۱۰ به عنوان یک [[داروی عمومی]] در دسترس قرار گرفت.
 
== موارد تجویز ==
1۱- درمان کوتاه مدت ازوفاژیت مرتبط با رفلاکس برای بزرگسالان و کودکان بالای 5۵ سال
 
2۲- کنترل بیماری هایبیماری‌های مرتبط پس از بدست آمدن نتایج اولیه از بیماری ، به مدت کمتر از 12۱۲ ماه .
 
3۳- درمان ترکیبی زخم هایزخم‌های گوارشی ناشی از [[هلیکوباکتر پیلوری]] . در این درمان از یک آنتی بیوتیک نیز در کنار پنتوپرازول استفاده می شودمی‌شود.
 
4۴- درمان طولانی مدت سندروم زولینگر- الیسون
 
== عوارض جانبی ==