تریگونلین: تفاوت میان نسخه‌ها

۱٬۰۷۷ بایت اضافه‌شده ،  ۱۰ سال پیش
جعبه اطلاعات - به بالا اضافه شد
جز (r2.7.1) (ربات: افزودن fr, hu, it, ja, ru)
(جعبه اطلاعات - به بالا اضافه شد)
{{Chembox new
|Verifiedfields=changed
|verifiedrevid=470614745
|Name=Trigonelline
|ImageFile=Trigonelline.png
<!-- |ImageSize=120px -->
|ImageName=
|IUPACName=1-Methylpyridinium- 3-carboxylate
|OtherNames=Nicotinic acid N- methylbetaine<br />Coffearine<br />Caffearine<br />Gynesine<br />Trigenolline
|Section1={{Chembox Identifiers
|ChemSpiderID_Ref={{chemspidercite|correct|chemspider}}
|ChemSpiderID=5369
|PubChem=5570
|InChI=1/C7H7NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-5H,1H3
|InChIKey=WWNNZCOKKKDOPX-UHFFFAOYAV
|ChEMBL_Ref={{ebicite|correct|EBI}}
|ChEMBL=350675
|ChEMBL2=489961
|StdInChI_Ref={{stdinchicite|correct|chemspider}}
|StdInChI=1S/C7H7NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-5H,1H3
|StdInChIKey_Ref={{stdinchicite|correct|chemspider}}
|StdInChIKey=WWNNZCOKKKDOPX-UHFFFAOYSA-N
|CASNo_Ref={{cascite|changed|??}}
|CASNo=535-83-1
|ChEBI_Ref={{ebicite|correct|EBI}}
|ChEBI=18123
|SMILES=O=C([O-])c1ccc[n+](c1)C
}}
|Section2={{Chembox Properties
|C=7|H=7|O=2|N=1
|Density=? g/cm<sup>3</sup>
|MeltingPt=230–233&nbsp;°C (monohydrate)<br />258–259&nbsp;°C (hydrochloride)
}}
}}
 
'''تریگونلین''' {{انگلیسی|Trigonelline}} یک [[ترکیب شیمیایی]] با [[پاب‌کم|شناسه پاب‌کم]] 5570 است.
 
۱۷۹٬۶۴۵

ویرایش