تفاوت میان نسخه‌های «گوانین»

۲٬۰۲۶ بایت اضافه‌شده ،  ۸ سال پیش
درون‌ریزی خودکار مقاله‌ها - به بالا اضافه شد
(رده:زیست‌شناسی مولکولی افزوده شد با استفاده از وپ:رده‌ساز)
(درون‌ریزی خودکار مقاله‌ها - به بالا اضافه شد)
| Watchedfields = changed
| verifiedrevid = 443850318
| ImageFile1 = Guanin.svg
| ImageSize1 = 150px
| ImageFileL2 = Guanine-3D-balls.png
| ImageFileR2 = Guanine-3D-vdW.png
| ImageSizeL2 = 120px
| ImageSizeR2 = 120px
| IUPACName = 2-amino-1''H''-purin-6(9''H'')-one
| OtherNames = 2-amino-6-hydroxypurine,<br />2-aminohypoxanthine,<br />Guanine
| Section1 = {{Chembox Identifiers
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB02377
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16235
| SMILES = c1[nH]c2c(n1)c(=O)[nH]c(n2)N
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5Z93L87A1R
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C00242
| InChI = 1/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11)
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 744
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 219568
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| CASNo = 73-40-5
| CASNo_Ref = {{cascite|correct|CAS}}
| RTECS = MF8260000
| Section2 = {{Chembox Properties
| Formula = C<sub>5</sub>H<sub>5</sub>N<sub>5</sub>O
| MolarMass = 151.13 g/mol
| Appearance = White amorphous solid.
| Density = 2.2 g/cm<sup>3</sup> (calculated)
| Solubility = Insoluble.
| MeltingPt = 360&nbsp;°C (633.15 K) ''decomp.''
| BoilingPt = Sublimes
| pKa=3.3 (amide), 9.2 (secondary), 12.3 (primary)<ref>Dawson, R.M.C., et al., ''Data for Biochemical Research'', Oxford, Clarendon Press, 1959.</ref>
| Dipole =
| Section7 = {{Chembox Hazards
| MainHazards = Irritant.
| NFPA-H = 1
| NFPA-F = 1
| NFPA-R =
| FlashPt = Non-flammable.
}}| Section8 = {{Chembox Related
| OtherAnions =
| OtherCations =
| OtherCpds = [[سیتوزین]]; [[آدنین]]; [[تیمین]]; [[اوراسیل]]
[[پرونده:Guanin.svg|بندانگشتی|250px|چپ|باز گوانين]]
'''گوانین''' یک [[باز نوکلئوتیدی]] و از مشتقات [[پورین]] است که در ساختار [[آران‌ای]] و [[دی‌ان‌ای]] (در دنا و رنا<ref>دنا و رنابر اساس واژگان گردآوری شدهٔ فرهنگستان زبان وادب فارسی به ترتیب بر گردان دی ان ای و آر ان ای هستند.</ref>) دیده می‌شود.
