تفاوت میان نسخه‌های «لوتئین»

۲٬۵۰۸ بایت اضافه‌شده ،  ۸ سال پیش
درون‌ریزی خودکار مقاله‌ها - به بالا اضافه شد
جز (ربات رده همسنگ: افزودن> رده:الکل‌ها)
(درون‌ریزی خودکار مقاله‌ها - به بالا اضافه شد)
{{chembox
| verifiedrevid = 457657742
| ImageFile = Luteine - Lutein.svg
| ImageSize = 250px
| IUPACName = β,ε-carotene-3,3'-diol
| OtherNames = Luteine; ''trans''-lutein; 4-​[18-​(4-​Hydroxy-​2,6,6-​trimethyl-​1-​cyclohexenyl)-​3,7,12,16-​tetramethyloctadeca-​1,3,5,7,9,11,13,15,17-​nonaenyl]-​3,5,5-​trimethyl-​cyclohex-​2-​en-​1-​ol
| Section1 = {{Chembox Identifiers
| Abbreviations =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4444655
| InChI = 1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-25,35-37,41-42H,26-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-,36+,37-/m0/s1
| InChIKey = KBPHJBAIARWVSC-RGZFRNHPBY
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-25,35-37,41-42H,26-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-,36+,37-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KBPHJBAIARWVSC-RGZFRNHPSA-N
| InChIKey1 = KBPHJBAIARWVSC-RGZFRNHPSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 127-40-2
| EINECS =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 173929
| PubChem = 5281243
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = X72A60C9MT
| SMILES = CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/[C@H]2C(=C[C@@H](CC2(C)C)O)C)/C)/C
| InChI =
| RTECS =
| MeSHName =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 28838
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties
|C=40|H=56|O=2
| MolarMass =568.871 g/mol
| Appearance =Red-orange crystalline solid
| Density =
| MeltingPt = 190 °C<ref name="Ref_">[http://www.carl-roth.de/jsp/de-de/sdpdf/5671.PDF ''MSDS at Carl Roth (Lutein Rotichrom, German)''.]</ref>
| Melting_notes =
| BoilingPt =
| Boiling_notes =
| Solubility = Insoluble
| SolubleOther = Soluble
| Solvent = fats
| pKa =
| pKb = }}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUClass =
| EUIndex =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
| PEL = }}
}}
'''لوتئین''' {{انگلیسی|Lutein}} یک [[ترکیب شیمیایی]] با [[پاب‌کم|شناسه پاب‌کم]] ۵۲۸۱۲۴۳ است. که [[جرم مولی]] آن 568.871 g/mol می‌باشد. شکل ظاهری این ترکیب، بلورهای جامد نارنجی-قرمز است.
==جستارهای وابسته==
۱۷۲٬۷۷۹

ویرایش