تفاوت میان نسخه‌های «استواستیل-کوآ»

۱٬۶۵۵ بایت اضافه‌شده ،  ۹ سال پیش
درون‌ریزی خودکار مقاله‌ها - به بالا اضافه شد
جز (ربات رده همسنگ: افزودن> رده:کوآنزیم‌ها)
(درون‌ریزی خودکار مقاله‌ها - به بالا اضافه شد)
{{chembox
| verifiedrevid = 452769270
|ImageFile=Acetoacetyl coenzyme A.svg
|ImageSize=300px
|IUPACName=
|OtherNames=
|Section1= {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 83198
| InChI = 1/C25H40N7O18P3S/c1-13(33)8-16(35)54-7-6-27-15(34)4-5-28-23(38)20(37)25(2,3)10-47-53(44,45)50-52(42,43)46-9-14-19(49-51(39,40)41)18(36)24(48-14)32-12-31-17-21(26)29-11-30-22(17)32/h11-12,14,18-20,24,36-37H,4-10H2,1-3H3,(H,27,34)(H,28,38)(H,42,43)(H,44,45)(H2,26,29,30)(H2,39,40,41)/t14-,18-,19-,20+,24-/m1/s1
| InChIKey = OJFDKHTZOUZBOS-CITAKDKDBD
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C25H40N7O18P3S/c1-13(33)8-16(35)54-7-6-27-15(34)4-5-28-23(38)20(37)25(2,3)10-47-53(44,45)50-52(42,43)46-9-14-19(49-51(39,40)41)18(36)24(48-14)32-12-31-17-21(26)29-11-30-22(17)32/h11-12,14,18-20,24,36-37H,4-10H2,1-3H3,(H,27,34)(H,28,38)(H,42,43)(H,44,45)(H2,26,29,30)(H2,39,40,41)/t14-,18-,19-,20+,24-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OJFDKHTZOUZBOS-CITAKDKDSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=1420-36-6
| PubChem=74
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 15345
| SMILES = O=C(C)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3OP(=O)(O)O
| MeSHName=acetoacetyl+CoA
}}
|Section2= {{Chembox Properties
| Formula=C<sub>25</sub>H<sub>40</sub>N<sub>7</sub>O<sub>18</sub>P<sub>3</sub>S
| MolarMass=851.609 g/mol
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3= {{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}}
'''استواستیل-کوآ''' {{انگلیسی|Acetoacetyl-CoA}} با [[فرمول شیمیایی]] C<sub>۲۵</sub>H<sub>۴۰</sub>N<sub>۷</sub>O<sub>۱۸</sub>P<sub>۳</sub>S یک [[ترکیب شیمیایی]] با [[پاب‌کم|شناسه پاب‌کم]] ۷۴ است. که [[جرم مولی]] آن ۸۵۱٫۶۰۹ g/mol می‌باشد.
==جستارهای وابسته==
۱۷۹٬۵۷۹

ویرایش