تفاوت میان نسخه‌های «ام‌دی‌وی۳۱۰۰»

۷۹۴ بایت اضافه‌شده ،  ۸ سال پیش
درون‌ریزی خودکار مقاله‌ها - به بالا اضافه شد
جز (ربات رده همسنگ: افزودن> رده:نیتریل‌ها)
(درون‌ریزی خودکار مقاله‌ها - به بالا اضافه شد)
{{chembox
| verifiedrevid = 451576971
| ImageFile = Antiandrogen_MDV3100.png
| ImageSize = 200px
| IUPACName = 4-(3-(4-cyano-3-(trifluoromethyl)phenyl)-5,5-dimethyl-4-oxo-2-thioxoimidazolidin-1-yl)-2-fluoro-N-methylbenzamide
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=915087-33-1
| PubChem=15951529
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 93T0T9GKNU
| SMILES=N#Cc1c(C(F)(F)F)cc(N2C(C(C)(C)N(c3ccc(C(N(C)[H])=O)c(F)c3)C2=S)=O)cc1
}}
| Section2 = {{Chembox Properties
| Formula=C<sub>21</sub>H<sub>16</sub>F<sub>4</sub>N<sub>4</sub>O<sub>2</sub>S
| MolarMass=464.44 g/mol
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
| Section3 = {{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}}
'''ام‌دی‌وی۳۱۰۰''' {{انگلیسی|MDV3100}} با [[فرمول شیمیایی]] C<sub>۲۱</sub>H<sub>۱۶</sub>F<sub>۴</sub>N<sub>۴</sub>O<sub>۲</sub>S یک [[ترکیب شیمیایی]] با [[پاب‌کم|شناسه پاب‌کم]] ۱۵۹۵۱۵۲۹ است. که [[جرم مولی]] آن ۴۶۴٫۴۴ g/mol می‌باشد.
==جستارهای وابسته==
۱٬۲۵۸

ویرایش