تفاوت میان نسخه‌های «نئومایسین»

۲٬۱۵۲ بایت اضافه‌شده ،  ۸ سال پیش
بدون خلاصه ویرایش
جز (r2.7.1) (ربات: افزودن ca:Neomicina)
{{ویکی‌سازی}}
{{drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 462259305
| IUPAC_name = (2S,3S,4S,5R)-5-amino-2-(aminomethyl)-6-((2R,3S,4R,5S)-5-((1R,2R,5R,6R)-3,5-diamino-2-((2R,3S,4R,5S)-3-amino-6-(aminomethyl)-4,5-dihydroxytetrahydro-2H-pyran-2-yloxy)-6-hydroxycyclohexyloxy)-4-hydroxy-2-(hydroxymethyl)tetrahydrofuran-3-yloxy)tetrahydro-2H-pyran-3,4-diol
| image = Neomycin.gif
 
<!--Clinical data-->
| tradename = Neo-rx
| Drugs.com = {{drugs.com|monograph|neomycin-sulfate}}
| MedlinePlus = a682274
| pregnancy_category =
| legal_status = [[Over-the-counter drug|OTC]]
| routes_of_administration = [[Topical]], [[Mouth|Oral]]
 
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life = 2 to 3 hours
 
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 1404-04-2
| ATC_prefix = A01
| ATC_suffix = AB08
| ATC_supplemental = {{ATC|A07|AA01}}, {{ATC|B05|CA09}}, {{ATC|D06|AX04}}, {{ATC|J01|GB05}}, {{ATC|R02|AB01}}, {{ATC|S01|AA03}}, {{ATC|S02|AA07}}, {{ATC|S03|AA01}}
| PubChem = 8378
| IUPHAR_ligand = 709
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00994
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8075
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = I16QD7X297
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08260
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 7508
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 449118
 
<!--Chemical data-->
| C=23 | H=46 | N=6 | O=13
| molecular_weight = 614.644 g/mol
| smiles = O([C@H]3[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N)[C@H]2O)[C@@H](O)[C@H](N)C[C@@H]3N)[C@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4N)CN
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C23H46N6O13/c24-2-7-13(32)15(34)10(28)21(37-7)40-18-6(27)1-5(26)12(31)20(18)42-23-17(36)19(9(4-30)39-23)41-22-11(29)16(35)14(33)8(3-25)38-22/h5-23,30-36H,1-4,24-29H2/t5-,6+,7-,8+,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PGBHMTALBVVCIT-VCIWKGPPSA-N
}}
 
'''نئومایسین''' {{انگلیسی|Neomycin}}