بکلومتازون: تفاوت میان نسخه‌ها

۲٬۵۶۲ بایت اضافه‌شده ،  ۹ سال پیش
بدون خلاصۀ ویرایش
بدون خلاصۀ ویرایش
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 459526640
| IUPAC_name = (8''S'',9''R'',10''S'',11''S'',13''S'',14''S'',16''S'',17''R'')-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-[2-(propionyloxy)acetyl]-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3''H''-cyclopenta[''a'']phenanthren-17-yl propionate
| image = Beclometasone dipropionate.png
| width = 200
 
<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|beclometasone-dipropionate}}
| pregnancy_AU = B3
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = S2
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = POM
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| routes_of_administration = Oral & nasal inhalation, topical
 
<!--Pharmacokinetic data-->
| bioavailability = Converted to beclometasone-17-monopropionate (17-BMP) during absorption
| protein_bound = 87% of 17-BMP to albumin and transcortin
| metabolism = By [[esterase]] enzymes found in most tissues
| elimination_half-life = 2.8 hours
| excretion = ?
 
<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 5534-09-8
| ATC_prefix = A07
| ATC_suffix = EA07
| ATC_supplemental = {{ATC|D07|AC15}}, {{ATC|R01|AD01}}, {{ATC|R03|BA01}}
| PubChem = 21700
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00394
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 20396
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5B307S63B2
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 3002
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200500
 
<!--Chemical data-->
| C=28 | H=37 | Cl=1 | O=7
| molecular_weight = 521.042 g/mol
| smiles = O=C(OCC(=O)[C@]3(OC(=O)CC)[C@]2(C[C@H](O)[C@]4(Cl)[C@@]/1(\C(=C/C(=O)\C=C\1)CC[C@H]4[C@@H]2C[C@@H]3C)C)C)CC
| InChI = 1/C28H37ClO7/c1-6-23(33)35-15-22(32)28(36-24(34)7-2)16(3)12-20-19-9-8-17-13-18(30)10-11-25(17,4)27(19,29)21(31)14-26(20,28)5/h10-11,13,16,19-21,31H,6-9,12,14-15H2,1-5H3/t16-,19-,20-,21-,25-,26-,27-,28-/m0/s1
| InChIKey = KUVIULQEHSCUHY-XYWKZLDCBO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C28H37ClO7/c1-6-23(33)35-15-22(32)28(36-24(34)7-2)16(3)12-20-19-9-8-17-13-18(30)10-11-25(17,4)27(19,29)21(31)14-26(20,28)5/h10-11,13,16,19-21,31H,6-9,12,14-15H2,1-5H3/t16-,19-,20-,21-,25-,26-,27-,28-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KUVIULQEHSCUHY-XYWKZLDCSA-N
}}
'''بکلومتازون''' {{انگلیسی|Beclometasone}}