تفاوت میان نسخه‌های «ام‌دی‌وی۳۱۰۰»

جز
جز (r2.7.2+) (ربات: اصلاح fr:Enzalutamide)
جز (ربات ردهٔ همسنگ (۲۳) +مرتب (۴٫۳): + رده:بنزامیدها)
| UNII = 93T0T9GKNU
| SMILES=N#Cc1c(C(F)(F)F)cc(N2C(C(C)(C)N(c3ccc(C(N(C)[H])=O)c(F)c3)C2=S)=O)cc1
}}
| Section2 = {{Chembox Properties
| Formula=C<sub>21</sub>H<sub>16</sub>F<sub>4</sub>N<sub>4</sub>O<sub>2</sub>S
| BoilingPt=
| Solubility=
}}
| Section3 = {{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}}
'''ام‌دی‌وی۳۱۰۰''' {{انگلیسی|MDV3100}} با [[فرمول شیمیایی]] C<sub>۲۱</sub>H<sub>۱۶</sub>F<sub>۴</sub>N<sub>۴</sub>O<sub>۲</sub>S یک [[ترکیب شیمیایی]] با [[پاب‌کم|شناسه پاب‌کم]] ۱۵۹۵۱۵۲۹ است. که [[جرم مولی]] آن ۴۶۴٫۴۴ g/mol می‌باشد.
== جستارهای وابسته ==
*[[ترکیب شیمیایی]]
*[[نام‌گذاری اتحادیه بین‌المللی شیمی محض و کاربردی]]
 
== منابع ==
{{پانویس}}
*{{یادکرد وب|نویسنده = |نشانی =http://goldbook.iupac.org/ |عنوان =IUPAC GOLD BOOK | ناشر = |تاریخ = |تاریخ بازدید =۱۸ مارس ۲۰۱۲ }}
 
{{شیمی-خرد}}
 
[[رده:اعضای فلوئوریدها]]
[[رده:بنزامیدها]]
[[رده:داروها]]
[[رده:لاکتام‌ها]]
۹۸٬۹۰۸

ویرایش