تریگونلین: تفاوت میان نسخه‌ها

۶۱ بایت اضافه‌شده ،  ۱۰ سال پیش
جز
ویرایش با ابرابزار
جز (ربات:استانداردسازی متن)
جز (ویرایش با ابرابزار)
{{Chembox new
|Verifiedfields=changed
|verifiedrevid=470614745۴۷۰۶۱۴۷۴۵
|Name=Trigonelline
|ImageFile=Trigonelline.png
|ImageName=
|IUPACName=1-Methylpyridinium- 3-carboxylate
|OtherNames=Nicotinic acid N- methylbetaine<br />{{سخ}}Coffearine<br />{{سخ}}Caffearine<br />{{سخ}}Gynesine<br />{{سخ}}Trigenolline
|Section1={{Chembox Identifiers
|ChemSpiderID_Ref={{chemspidercite|correct|chemspider}}
|ChemSpiderID=5369۵۳۶۹
|PubChem=5570۵۵۷۰
|InChI=1/C7H7NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-5H,1H3
|InChIKey=WWNNZCOKKKDOPX-UHFFFAOYAV
|ChEMBL_Ref={{ebicite|correct|EBI}}
|ChEMBL=350675۳۵۰۶۷۵
|ChEMBL2=489961۴۸۹۹۶۱
|StdInChI_Ref={{stdinchicite|correct|chemspider}}
|StdInChI=1S/C7H7NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-5H,1H3
|StdInChIKey=WWNNZCOKKKDOPX-UHFFFAOYSA-N
|CASNo_Ref={{cascite|changed|??}}
|CASNo=535۵۳۵-83۸۳-1۱
|ChEBI_Ref={{ebicite|correct|EBI}}
|ChEBI=18123۱۸۱۲۳
|SMILES=O=C([O-])c1ccc[n+](c1)C
}}
|Section2={{Chembox Properties
|C=7۷|H=7۷|O=2۲|N=1۱
|Density=? g/cm<sup>3۳</sup>
|MeltingPt=230–233&nbsp;°C (monohydrate)<br />{{سخ}}258–259&nbsp;°C (hydrochloride)
}}
}}
 
'''تریگونلین''' {{انگلیسی|Trigonelline}} یک [[ترکیب شیمیایی]] با [[پاب‌کم|شناسه پاب‌کم]] 5570۵۵۷۰ است.
 
 
 
== جستارهای وابسته ==
* [[ترکیب شیمیایی]]
* [[نام‌گذاری اتحادیه بین‌المللی شیمی محض و کاربردی]]
 
== منابع ==
{{پانویس}}
* {{یادکرد وب|نویسنده = |نشانی =http://goldbook.iupac.org/ |عنوان =IUPAC GOLD BOOK | ناشر = |تاریخ = |تاریخ بازدید =۱۸ مارس ۲۰۱۲ }}
{{شیمی-خرد}}
[[رده:آلکالوئیدها]]
۵۲٬۹۸۶

ویرایش