هیدروکسیزین: تفاوت میان نسخهها
محتوای حذفشده محتوای افزودهشده
جز ربات:افزودن الگو ناوباکس {{هیستامینرژیک}} |
بدون خلاصۀ ویرایش |
||
خط ۱:
{{Drugbox
| verifiedrevid = 461774177
| IUPAC_name = (±)-2-(2-{4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl}ethoxy)ethanol
| image = Hydroxyzine.svg
| image2 = Hydroxyzine-3d-sticks.png
<!--Clinical data-->
| tradename = Vistaril
| Drugs.com = {{drugs.com|monograph|hydroxyzine-hydrochloride}}
| MedlinePlus = a682866
| pregnancy_AU = A
| pregnancy_US = C
| legal_status = Rx-only
| routes_of_administration = [[Mouth|Oral]], [[Intramuscular injection|IM]]
<!--Pharmacokinetic data-->
| bioavailability = High [[In vivo|in-vivo]]
| protein_bound = 93%
| metabolism = [[Renal]]
| elimination_half-life = 20.0 ± 4.1 hours<ref name="pmid6141198">{{cite journal | author = Simons FE, Simons KJ, Frith EM | title = The pharmacokinetics and antihistaminic of the H1 receptor antagonist hydroxyzine | journal = The Journal of Allergy and Clinical Immunology | volume = 73 | issue = 1 Pt 1 | pages = 69–75 | year = 1984 | month = January | pmid = 6141198 | doi = | url = }}</ref>
| excretion = [[Urine]], [[Feces]]
<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 68-88-2
| ATC_prefix = N05
| ATC_suffix = BB01
| PubChem = 3658
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00557
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3531
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 30S50YM8OG
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08054
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 5818
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 896
<!--Chemical data-->
| C = 21 | H = 27 | Cl = 1 | N = 2 | O = 2
| molecular_weight = 374.904 g/mol
| smiles = Clc1ccc(cc1)C(c2ccccc2)N3CCN(CC3)CCOCCO
| InChI = 1/C21H27ClN2O2/c22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25/h1-9,21,25H,10-17H2
| InChIKey = ZQDWXGKKHFNSQK-UHFFFAOYAL
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H27ClN2O2/c22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25/h1-9,21,25H,10-17H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZQDWXGKKHFNSQK-UHFFFAOYSA-N
}}
'''هیدروکسی زین''' {{انگلیسی|Hydroxyzine}}
| |||