تفاوت میان نسخه‌های «دیاتریزوئیک اسید»

ابرابزار
(ابرابزار)
{{chembox
| Verifiedfields = changed
| verifiedrevid = 460781662۴۶۰۷۸۱۶۶۲
| Name = Diatrizoic acid
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageFile = Diatrizoic acid.svg
| ImageSize = 180px
| ImageAlt = Skeletal formula
| ImageFile1 = Diatrizoic-acid-3D-spacefill.png
| ImageSize1 = 180px
| ImageAlt1 = Space-filling model
| IUPACName = 3,5-bis(acetylamino)-2,4,6-triiodobenzoic acid
| Section1 = {{Chembox Identifiers
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02240
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1201220۱۲۰۱۲۲۰
| InChI = 1/C11H9I3N2O4/c1-3(17)15-9-6(12)5(11(19)20)7(13)10(8(9)14)16-4(2)18/h1-2H3,(H,15,17)(H,16,18)(H,19,20۱۹٬۲۰)
| InChIKey = YVPYQUNUQOZFHG-UHFFFAOYAT
| SMILES1 = Ic1c(c(I)c(c(I)c1NC(=O)C)C(=O)O)NC(=O)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H9I3N2O4/c1-3(17)15-9-6(12)5(11(19)20)7(13)10(8(9)14)16-4(2)18/h1-2H3,(H,15,17)(H,16,18)(H,19,20۱۹٬۲۰)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YVPYQUNUQOZFHG-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 737۷۳۷-31۳۱-5۵
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2055۲۰۵۵
| PubChem = 2140۲۱۴۰
| ATCCode_prefix = V08
| ATCCode_suffix = AA01
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 53691۵۳۶۹۱
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00271
}}
| Section2 = {{Chembox Properties
|C=11|H=9|I=3|N=2|O=4۴
| MolarMass = 613.9 g/mol
| Density =
| MeltingPt =
| BoilingPt =
}}
}}
'''دیاتریزوئیک اسید''' {{انگلیسی|Diatrizoic acid}} یا اوروگرافین یک [[ترکیب شیمیایی]] با [[پاب‌کم|شناسه پاب‌کم]] ۲۱۴۰ است.است؛ که [[جرم مولی]] آن ۶۱۳٫۹ g/mol می‌باشد. این ماده حاجب یددار در تصویربرداری پزشکی کاربرد دارد.
 
== جستارهای وابسته ==
* [[کنتراست یددار]]
* [[ترکیب شیمیایی]]
* [[ماده حاجب]]
* [[نام‌گذاری اتحادیه بین‌المللی شیمی محض و کاربردی]]
 
== منابع ==